C24H33ClN4O3+2 — CID 4248309
3-[(2-chlorophenyl)methyl]-N-[3-(4-methylpiperazine-1,4-diium-1-yl)propyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide (PubChem CID 4248309) has the molecular formula C24H33ClN4O3+2 and a molecular weight of 461.01 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-N-[3-(4-methylpiperazine-1,4-diium-1-yl)propyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide.
| Compound Name | 3-[(2-chlorophenyl)methyl]-N-[3-(4-methylpiperazine-1,4-diium-1-yl)propyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
|---|---|
| PubChem CID | 4248309 |
| Molecular Formula | C24H33ClN4O3+2 |
| Molecular Weight | 461.01 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-N-[3-(4-methylpiperazine-1,4-diium-1-yl)propyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
| SMILES | C[NH+]1CC[NH+](CCCNC(=O)C2C3C=CC4(CN(Cc5ccccc5Cl)C(=O)C24)O3)CC1 |
| InChI | InChI=1S/C24H31ClN4O3/c1-27-11-13-28(14-12-27)10-4-9-26-22(30)20-19-7-8-24(32-19)16-29(23(31)21(20)24)15-17-5-2-3-6-18(17)25/h2-3,5-8,19-21H,4,9-16H2,1H3,(H,26,30)/p+2 |
| InChIKey | ZLGUABDEODKMKM-UHFFFAOYSA-P |
| XLogP | -1.46 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.01 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|