C24H31ClN4O3 — CID 98184647
(1R,5S,6S,7R)-3-[(2-chlorophenyl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide (PubChem CID 98184647) has the molecular formula C24H31ClN4O3 and a molecular weight of 458.99 g/mol. Its IUPAC name is (1R,5S,6S,7R)-3-[(2-chlorophenyl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide.
| Compound Name | (1R,5S,6S,7R)-3-[(2-chlorophenyl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
|---|---|
| PubChem CID | 98184647 |
| Molecular Formula | C24H31ClN4O3 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | (1R,5S,6S,7R)-3-[(2-chlorophenyl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
| SMILES | CN1CCN(CCCNC(=O)[C@@H]2[C@H]3C=C[C@@]4(CN(Cc5ccccc5Cl)C(=O)[C@@H]24)O3)CC1 |
| InChI | InChI=1S/C24H31ClN4O3/c1-27-11-13-28(14-12-27)10-4-9-26-22(30)20-19-7-8-24(32-19)16-29(23(31)21(20)24)15-17-5-2-3-6-18(17)25/h2-3,5-8,19-21H,4,9-16H2,1H3,(H,26,30)/t19-,20-,21-,24+/m1/s1 |
| InChIKey | ZLGUABDEODKMKM-CTVDGRRTSA-N |
| XLogP | 1.38 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|