C24H29ClN2O3 — CID 87049821
(5S,7R)-3-[(2-chlorophenyl)methyl]-N-cyclooctyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide (PubChem CID 87049821) has the molecular formula C24H29ClN2O3 and a molecular weight of 428.96 g/mol. Its IUPAC name is (5S,7R)-3-[(2-chlorophenyl)methyl]-N-cyclooctyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide.
| Compound Name | (5S,7R)-3-[(2-chlorophenyl)methyl]-N-cyclooctyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
|---|---|
| PubChem CID | 87049821 |
| Molecular Formula | C24H29ClN2O3 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (5S,7R)-3-[(2-chlorophenyl)methyl]-N-cyclooctyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)C1[C@H]2C=CC3(CN(Cc4ccccc4Cl)C(=O)[C@@H]13)O2 |
| InChI | InChI=1S/C24H29ClN2O3/c25-18-11-7-6-8-16(18)14-27-15-24-13-12-19(30-24)20(21(24)23(27)29)22(28)26-17-9-4-2-1-3-5-10-17/h6-8,11-13,17,19-21H,1-5,9-10,14-15H2,(H,26,28)/t19-,20?,21-,24?/m1/s1 |
| InChIKey | ZTLHNTBOFOJDIP-LXEVQABCSA-N |
| XLogP | 3.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|