C23H28FNO2 — CID 42500679
N-cyclopentyl-N-[[3-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-methylpropanamide (PubChem CID 42500679) has the molecular formula C23H28FNO2 and a molecular weight of 369.48 g/mol. Its IUPAC name is N-cyclopentyl-N-[[3-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-methylpropanamide.
| Compound Name | N-cyclopentyl-N-[[3-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 42500679 |
| Molecular Formula | C23H28FNO2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-cyclopentyl-N-[[3-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)N(Cc1cccc(OCc2ccc(F)cc2)c1)C1CCCC1 |
| InChI | InChI=1S/C23H28FNO2/c1-17(2)23(26)25(21-7-3-4-8-21)15-19-6-5-9-22(14-19)27-16-18-10-12-20(24)13-11-18/h5-6,9-14,17,21H,3-4,7-8,15-16H2,1-2H3 |
| InChIKey | CUGOQYLERYFCMV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |