C22H37N3O3S — CID 42519287
(4aS,8aR)-2-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline (PubChem CID 42519287) has the molecular formula C22H37N3O3S and a molecular weight of 423.62 g/mol. Its IUPAC name is (4aS,8aR)-2-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline.
| Compound Name | (4aS,8aR)-2-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 42519287 |
| Molecular Formula | C22H37N3O3S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | (4aS,8aR)-2-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
| SMILES | COCCCn1c(CN2CC[C@@H]3CCCC[C@H]3C2)cnc1S(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C22H37N3O3S/c1-28-14-6-12-25-20(15-23-22(25)29(26,27)21-9-4-5-10-21)17-24-13-11-18-7-2-3-8-19(18)16-24/h15,18-19,21H,2-14,16-17H2,1H3/t18-,19-/m0/s1 |
| InChIKey | FHKWKRDHNOMAGZ-OALUTQOASA-N |
| XLogP | 3.65 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|