C20H37N3O3S — CID 42512854
[1-[[3-butyl-2-(4-methylpentylsulfonyl)imidazol-4-yl]methyl]piperidin-4-yl]methanol (PubChem CID 42512854) has the molecular formula C20H37N3O3S and a molecular weight of 399.60 g/mol. Its IUPAC name is [1-[[3-butyl-2-(4-methylpentylsulfonyl)imidazol-4-yl]methyl]piperidin-4-yl]methanol.
| Compound Name | [1-[[3-butyl-2-(4-methylpentylsulfonyl)imidazol-4-yl]methyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 42512854 |
| Molecular Formula | C20H37N3O3S |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | [1-[[3-butyl-2-(4-methylpentylsulfonyl)imidazol-4-yl]methyl]piperidin-4-yl]methanol |
| SMILES | CCCCn1c(CN2CCC(CO)CC2)cnc1S(=O)(=O)CCCC(C)C |
| InChI | InChI=1S/C20H37N3O3S/c1-4-5-10-23-19(15-22-11-8-18(16-24)9-12-22)14-21-20(23)27(25,26)13-6-7-17(2)3/h14,17-18,24H,4-13,15-16H2,1-3H3 |
| InChIKey | IUQGORPQYPYQNJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |