C20H29N7O2 — CID 42531125
1-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-[5-(pyrrolidin-1-ylmethyl)tetrazol-1-yl]ethanone (PubChem CID 42531125) has the molecular formula C20H29N7O2 and a molecular weight of 399.50 g/mol. Its IUPAC name is 1-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-[5-(pyrrolidin-1-ylmethyl)tetrazol-1-yl]ethanone.
| Compound Name | 1-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-[5-(pyrrolidin-1-ylmethyl)tetrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 42531125 |
| Molecular Formula | C20H29N7O2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 1-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-[5-(pyrrolidin-1-ylmethyl)tetrazol-1-yl]ethanone |
| SMILES | CCOc1ccccc1N1CCN(C(=O)Cn2nnnc2CN2CCCC2)CC1 |
| InChI | InChI=1S/C20H29N7O2/c1-2-29-18-8-4-3-7-17(18)25-11-13-26(14-12-25)20(28)16-27-19(21-22-23-27)15-24-9-5-6-10-24/h3-4,7-8H,2,5-6,9-16H2,1H3 |
| InChIKey | JLWFVVPBLXJONI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 79.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |