C23H28N4O2S — CID 9415491
4-(1H-benzimidazol-2-ylsulfanyl)-1-[4-(2-ethoxyphenyl)piperazin-1-yl]butan-1-one (PubChem CID 9415491) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanyl)-1-[4-(2-ethoxyphenyl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanyl)-1-[4-(2-ethoxyphenyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 9415491 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanyl)-1-[4-(2-ethoxyphenyl)piperazin-1-yl]butan-1-one |
| SMILES | CCOc1ccccc1N1CCN(C(=O)CCCSc2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C23H28N4O2S/c1-2-29-21-11-6-5-10-20(21)26-13-15-27(16-14-26)22(28)12-7-17-30-23-24-18-8-3-4-9-19(18)25-23/h3-6,8-11H,2,7,12-17H2,1H3,(H,24,25) |
| InChIKey | BGCZHTQUSXUCEQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|