C21H30N5O2S+ — CID 9117203
4-(1H-benzimidazol-2-ylsulfanyl)-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-4-ium-1-yl]butan-1-one (PubChem CID 9117203) has the molecular formula C21H30N5O2S+ and a molecular weight of 416.57 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanyl)-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-4-ium-1-yl]butan-1-one.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanyl)-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-4-ium-1-yl]butan-1-one |
|---|---|
| PubChem CID | 9117203 |
| Molecular Formula | C21H30N5O2S+ |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanyl)-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-4-ium-1-yl]butan-1-one |
| SMILES | O=C(CCCSc1nc2ccccc2[nH]1)N1CC[NH+](CC(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C21H29N5O2S/c27-19(8-5-15-29-21-22-17-6-1-2-7-18(17)23-21)26-13-11-24(12-14-26)16-20(28)25-9-3-4-10-25/h1-2,6-7H,3-5,8-16H2,(H,22,23)/p+1 |
| InChIKey | AVTXQSPSBVLMFP-UHFFFAOYSA-O |
| XLogP | 0.78 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|