C26H31N3OS — CID 170246190
4-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]-1-piperidin-1-ylbutan-1-one (PubChem CID 170246190) has the molecular formula C26H31N3OS and a molecular weight of 433.62 g/mol. Its IUPAC name is 4-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]-1-piperidin-1-ylbutan-1-one.
| Compound Name | 4-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]-1-piperidin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 170246190 |
| Molecular Formula | C26H31N3OS |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 4-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]-1-piperidin-1-ylbutan-1-one |
| SMILES | Cc1ccc(-c2nc(SCCCC(=O)N3CCCCC3)[nH]c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H31N3OS/c1-19-8-12-21(13-9-19)24-25(22-14-10-20(2)11-15-22)28-26(27-24)31-18-6-7-23(30)29-16-4-3-5-17-29/h8-15H,3-7,16-18H2,1-2H3,(H,27,28) |
| InChIKey | LITITBFCIJEEMN-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|