C23H31N4OS+ — CID 7305609
1-[4-(1-adamantyl)piperazin-4-ium-1-yl]-2-(1H-benzimidazol-2-ylsulfanyl)ethanone (PubChem CID 7305609) has the molecular formula C23H31N4OS+ and a molecular weight of 411.60 g/mol. Its IUPAC name is 1-[4-(1-adamantyl)piperazin-4-ium-1-yl]-2-(1H-benzimidazol-2-ylsulfanyl)ethanone.
| Compound Name | 1-[4-(1-adamantyl)piperazin-4-ium-1-yl]-2-(1H-benzimidazol-2-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 7305609 |
| Molecular Formula | C23H31N4OS+ |
| Molecular Weight | 411.60 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 1-[4-(1-adamantyl)piperazin-4-ium-1-yl]-2-(1H-benzimidazol-2-ylsulfanyl)ethanone |
| SMILES | O=C(CSc1nc2ccccc2[nH]1)N1CC[NH+](C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C23H30N4OS/c28-21(15-29-22-24-19-3-1-2-4-20(19)25-22)26-5-7-27(8-6-26)23-12-16-9-17(13-23)11-18(10-16)14-23/h1-4,16-18H,5-15H2,(H,24,25)/p+1 |
| InChIKey | BRIDMNYKWPBDTM-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.60 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |