C16H23NO3 — CID 42544367
methyl N-[(1R)-2,2,4-trimethyl-3-oxo-1-phenylpentyl]carbamate (PubChem CID 42544367) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is methyl N-[(1R)-2,2,4-trimethyl-3-oxo-1-phenylpentyl]carbamate.
| Compound Name | methyl N-[(1R)-2,2,4-trimethyl-3-oxo-1-phenylpentyl]carbamate |
|---|---|
| PubChem CID | 42544367 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | methyl N-[(1R)-2,2,4-trimethyl-3-oxo-1-phenylpentyl]carbamate |
| SMILES | COC(=O)N[C@H](c1ccccc1)C(C)(C)C(=O)C(C)C |
| InChI | InChI=1S/C16H23NO3/c1-11(2)14(18)16(3,4)13(17-15(19)20-5)12-9-7-6-8-10-12/h6-11,13H,1-5H3,(H,17,19)/t13-/m1/s1 |
| InChIKey | JYMRVVBXWDNNKU-CYBMUJFWSA-N |
| XLogP | 3.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |