C23H22F3NO2S — CID 4255361
3-(cyclohexylsulfanylmethyl)-N-[3-(trifluoromethyl)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 4255361) has the molecular formula C23H22F3NO2S and a molecular weight of 433.50 g/mol. Its IUPAC name is 3-(cyclohexylsulfanylmethyl)-N-[3-(trifluoromethyl)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | 3-(cyclohexylsulfanylmethyl)-N-[3-(trifluoromethyl)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 4255361 |
| Molecular Formula | C23H22F3NO2S |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 3-(cyclohexylsulfanylmethyl)-N-[3-(trifluoromethyl)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1oc2ccccc2c1CSC1CCCCC1 |
| InChI | InChI=1S/C23H22F3NO2S/c24-23(25,26)15-7-6-8-16(13-15)27-22(28)21-19(14-30-17-9-2-1-3-10-17)18-11-4-5-12-20(18)29-21/h4-8,11-13,17H,1-3,9-10,14H2,(H,27,28) |
| InChIKey | PXLIPYUOBVJYGD-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |