C23H26N2O4S — CID 55549464
3-(cyclohexylsulfanylmethyl)-N-[2-(furan-2-carbonylamino)ethyl]-1-benzofuran-2-carboxamide (PubChem CID 55549464) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is 3-(cyclohexylsulfanylmethyl)-N-[2-(furan-2-carbonylamino)ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 3-(cyclohexylsulfanylmethyl)-N-[2-(furan-2-carbonylamino)ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 55549464 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 3-(cyclohexylsulfanylmethyl)-N-[2-(furan-2-carbonylamino)ethyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCNC(=O)c1oc2ccccc2c1CSC1CCCCC1)c1ccco1 |
| InChI | InChI=1S/C23H26N2O4S/c26-22(20-11-6-14-28-20)24-12-13-25-23(27)21-18(15-30-16-7-2-1-3-8-16)17-9-4-5-10-19(17)29-21/h4-6,9-11,14,16H,1-3,7-8,12-13,15H2,(H,24,26)(H,25,27) |
| InChIKey | ZNCYLXJTBLCBRV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|