C28H27FN2O4S2 — CID 5177160
3-(cyclohexylsulfanylmethyl)-N-[2-[5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-benzofuran-2-carboxamide (PubChem CID 5177160) has the molecular formula C28H27FN2O4S2 and a molecular weight of 538.67 g/mol. Its IUPAC name is 3-(cyclohexylsulfanylmethyl)-N-[2-[5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 3-(cyclohexylsulfanylmethyl)-N-[2-[5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 5177160 |
| Molecular Formula | C28H27FN2O4S2 |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 3-(cyclohexylsulfanylmethyl)-N-[2-[5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCN1C(=O)SC(=Cc2ccccc2F)C1=O)c1oc2ccccc2c1CSC1CCCCC1 |
| InChI | InChI=1S/C28H27FN2O4S2/c29-22-12-6-4-8-18(22)16-24-27(33)31(28(34)37-24)15-14-30-26(32)25-21(17-36-19-9-2-1-3-10-19)20-11-5-7-13-23(20)35-25/h4-8,11-13,16,19H,1-3,9-10,14-15,17H2,(H,30,32) |
| InChIKey | YLXHLQBNKMJQFT-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|