C23H19FN2O5S — CID 2121393
N-[2-[(5E)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(methoxymethyl)-1-benzofuran-2-carboxamide (PubChem CID 2121393) has the molecular formula C23H19FN2O5S and a molecular weight of 454.48 g/mol. Its IUPAC name is N-[2-[(5E)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(methoxymethyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-[(5E)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(methoxymethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 2121393 |
| Molecular Formula | C23H19FN2O5S |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | N-[2-[(5E)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(methoxymethyl)-1-benzofuran-2-carboxamide |
| SMILES | COCc1c(C(=O)NCCN2C(=O)S/C(=C/c3ccccc3F)C2=O)oc2ccccc12 |
| InChI | InChI=1S/C23H19FN2O5S/c1-30-13-16-15-7-3-5-9-18(15)31-20(16)21(27)25-10-11-26-22(28)19(32-23(26)29)12-14-6-2-4-8-17(14)24/h2-9,12H,10-11,13H2,1H3,(H,25,27)/b19-12+ |
| InChIKey | GYFVETQBCFZPNP-XDHOZWIPSA-N |
| XLogP | 4.18 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|