C26H23N5O6S2 — CID 6218335
N-[2-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1-benzofuran-2-carboxamide (PubChem CID 6218335) has the molecular formula C26H23N5O6S2 and a molecular weight of 565.63 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 6218335 |
| Molecular Formula | C26H23N5O6S2 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.11 |
| IUPAC Name | N-[2-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc(/C=C2\SC(=O)N(CCNC(=O)c3oc4ccccc4c3CSc3ncn[nH]3)C2=O)cc1OC |
| InChI | InChI=1S/C26H23N5O6S2/c1-35-19-8-7-15(11-20(19)36-2)12-21-24(33)31(26(34)39-21)10-9-27-23(32)22-17(13-38-25-28-14-29-30-25)16-5-3-4-6-18(16)37-22/h3-8,11-12,14H,9-10,13H2,1-2H3,(H,27,32)(H,28,29,30)/b21-12- |
| InChIKey | NGSNZIDGEYLSJQ-MTJSOVHGSA-N |
| XLogP | 4.33 |
| TPSA | 139.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|