C22H20F3NO2S — CID 2413265
3-(cyclohexylsulfanylmethyl)-N-(2,3,4-trifluorophenyl)-1-benzofuran-2-carboxamide (PubChem CID 2413265) has the molecular formula C22H20F3NO2S and a molecular weight of 419.47 g/mol. Its IUPAC name is 3-(cyclohexylsulfanylmethyl)-N-(2,3,4-trifluorophenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 3-(cyclohexylsulfanylmethyl)-N-(2,3,4-trifluorophenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 2413265 |
| Molecular Formula | C22H20F3NO2S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 3-(cyclohexylsulfanylmethyl)-N-(2,3,4-trifluorophenyl)-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1oc2ccccc2c1CSC1CCCCC1 |
| InChI | InChI=1S/C22H20F3NO2S/c23-16-10-11-17(20(25)19(16)24)26-22(27)21-15(12-29-13-6-2-1-3-7-13)14-8-4-5-9-18(14)28-21/h4-5,8-11,13H,1-3,6-7,12H2,(H,26,27) |
| InChIKey | ZDOOQXYMDHXHTA-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|