About 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(E)-1-naphthalen-1-ylethylideneamino]acetamide
2-(2-methyl-1,3-dithiolan-2-yl)-N-[(E)-1-naphthalen-1-ylethylideneamino]acetamide (PubChem CID 42554221) has the molecular formula C18H20N2OS2
and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(E)-1-naphthalen-1-ylethylideneamino]acetamide.
Molecular Properties
| Compound Name | 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(E)-1-naphthalen-1-ylethylideneamino]acetamide |
| PubChem CID | 42554221 |
| Molecular Formula | C18H20N2OS2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(E)-1-naphthalen-1-ylethylideneamino]acetamide |
| SMILES | C/C(=N\NC(=O)CC1(C)SCCS1)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H20N2OS2/c1-13(15-9-5-7-14-6-3-4-8-16(14)15)19-20-17(21)12-18(2)22-10-11-23-18/h3-9H,10-12H2,1-2H3,(H,20,21)/b19-13+ |
| InChIKey | FMDUTUQTKNMJHN-CPNJWEJPSA-N |
| XLogP | 4.27 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(E)-1-naphthalen-1-ylethylideneamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(E)-1-naphthalen-1-ylethylideneamino]acetamide?
The IUPAC name of 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(E)-1-naphthalen-1-ylethylideneamino]acetamide (CID 42554221) is 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(E)-1-naphthalen-1-ylethylideneamino]acetamide.
What is the SMILES notation for 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(E)-1-naphthalen-1-ylethylideneamino]acetamide?
The canonical SMILES for 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(E)-1-naphthalen-1-ylethylideneamino]acetamide is C/C(=N\NC(=O)CC1(C)SCCS1)c1cccc2ccccc12.
What is the InChIKey of 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(E)-1-naphthalen-1-ylethylideneamino]acetamide?
The InChIKey is FMDUTUQTKNMJHN-CPNJWEJPSA-N. The full InChI is InChI=1S/C18H20N2OS2/c1-13(15-9-5-7-14-6-3-4-8-16(14)15)19-20-17(21)12-18(2)22-10-11-23-18/h3-9H,10-12H2,1-2H3,(H,20,21)/b19-13+.
What are the key properties of 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(E)-1-naphthalen-1-ylethylideneamino]acetamide?
2-(2-methyl-1,3-dithiolan-2-yl)-N-[(E)-1-naphthalen-1-ylethylideneamino]acetamide has a molecular weight of 344.50 g/mol, XLogP of 4.27, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(E)-1-naphthalen-1-ylethylideneamino]acetamide is sourced from PubChem (CID 42554221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).