C14H18N2O4S — CID 42554485
N-(2-ethenoxyethyl)-4-[(3R)-5-oxopyrrolidin-3-yl]benzenesulfonamide (PubChem CID 42554485) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-(2-ethenoxyethyl)-4-[(3R)-5-oxopyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | N-(2-ethenoxyethyl)-4-[(3R)-5-oxopyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 42554485 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-(2-ethenoxyethyl)-4-[(3R)-5-oxopyrrolidin-3-yl]benzenesulfonamide |
| SMILES | C=COCCNS(=O)(=O)c1ccc([C@@H]2CNC(=O)C2)cc1 |
| InChI | InChI=1S/C14H18N2O4S/c1-2-20-8-7-16-21(18,19)13-5-3-11(4-6-13)12-9-14(17)15-10-12/h2-6,12,16H,1,7-10H2,(H,15,17)/t12-/m0/s1 |
| InChIKey | YOOKYBSDWCQGKL-LBPRGKRZSA-N |
| XLogP | 0.73 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|