C20H32O11S — CID 42554903
[(2S,3R,4R,5S,6R)-2,3,4,5-tetraacetyloxy-6-ethoxy-6-ethylsulfanylhexyl] acetate (PubChem CID 42554903) has the molecular formula C20H32O11S and a molecular weight of 480.53 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-2,3,4,5-tetraacetyloxy-6-ethoxy-6-ethylsulfanylhexyl] acetate.
| Compound Name | [(2S,3R,4R,5S,6R)-2,3,4,5-tetraacetyloxy-6-ethoxy-6-ethylsulfanylhexyl] acetate |
|---|---|
| PubChem CID | 42554903 |
| Molecular Formula | C20H32O11S |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-2,3,4,5-tetraacetyloxy-6-ethoxy-6-ethylsulfanylhexyl] acetate |
| SMILES | CCO[C@H](SCC)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C20H32O11S/c1-8-26-20(32-9-2)19(31-15(7)25)18(30-14(6)24)17(29-13(5)23)16(28-12(4)22)10-27-11(3)21/h16-20H,8-10H2,1-7H3/t16-,17+,18+,19-,20+/m0/s1 |
| InChIKey | LFHSYOGDEXCBQM-MFKWGIFDSA-N |
| XLogP | 1.39 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|