C26H22N2O5 — CID 42566489
N-[3-(furan-2-yl)phenyl]-1-(4-oxochromene-2-carbonyl)piperidine-4-carboxamide (PubChem CID 42566489) has the molecular formula C26H22N2O5 and a molecular weight of 442.47 g/mol. Its IUPAC name is N-[3-(furan-2-yl)phenyl]-1-(4-oxochromene-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[3-(furan-2-yl)phenyl]-1-(4-oxochromene-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42566489 |
| Molecular Formula | C26H22N2O5 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-[3-(furan-2-yl)phenyl]-1-(4-oxochromene-2-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(-c2ccco2)c1)C1CCN(C(=O)c2cc(=O)c3ccccc3o2)CC1 |
| InChI | InChI=1S/C26H22N2O5/c29-21-16-24(33-23-8-2-1-7-20(21)23)26(31)28-12-10-17(11-13-28)25(30)27-19-6-3-5-18(15-19)22-9-4-14-32-22/h1-9,14-17H,10-13H2,(H,27,30) |
| InChIKey | ISAQWPYDWWXCDX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |