C18H24F2N2O3 — CID 42567158
methyl (2S,4S,5R)-4-(butylcarbamoyl)-5-(2,3-difluorophenyl)-1-methylpyrrolidine-2-carboxylate (PubChem CID 42567158) has the molecular formula C18H24F2N2O3 and a molecular weight of 354.40 g/mol. Its IUPAC name is methyl (2S,4S,5R)-4-(butylcarbamoyl)-5-(2,3-difluorophenyl)-1-methylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S,5R)-4-(butylcarbamoyl)-5-(2,3-difluorophenyl)-1-methylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 42567158 |
| Molecular Formula | C18H24F2N2O3 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | methyl (2S,4S,5R)-4-(butylcarbamoyl)-5-(2,3-difluorophenyl)-1-methylpyrrolidine-2-carboxylate |
| SMILES | CCCCNC(=O)[C@H]1C[C@@H](C(=O)OC)N(C)[C@H]1c1cccc(F)c1F |
| InChI | InChI=1S/C18H24F2N2O3/c1-4-5-9-21-17(23)12-10-14(18(24)25-3)22(2)16(12)11-7-6-8-13(19)15(11)20/h6-8,12,14,16H,4-5,9-10H2,1-3H3,(H,21,23)/t12-,14-,16-/m0/s1 |
| InChIKey | XFJHSNQBXRKINF-NOLJZWGESA-N |
| XLogP | 2.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|