C21H27F3N2O3 — CID 118722408
H-bAla(3R-Bn(2,4,5-triF))-Oic-OEt (PubChem CID 118722408) has the molecular formula C21H27F3N2O3 and a molecular weight of 412.40 g/mol. Its IUPAC name is ethyl (2S,3aS,7aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | H-bAla(3R-Bn(2,4,5-triF))-Oic-OEt |
|---|---|
| PubChem CID | 118722408 |
| Molecular Formula | C21H27F3N2O3 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | ethyl (2S,3aS,7aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1C(=O)C[C@@H](CC3=CC(=C(C=C3F)F)F)N |
| InChI | InChI=1S/C21H27F3N2O3/c1-2-29-21(28)19-9-12-5-3-4-6-18(12)26(19)20(27)10-14(25)7-13-8-16(23)17(24)11-15(13)22/h8,11-12,14,18-19H,2-7,9-10,25H2,1H3/t12-,14+,18-,19-/m0/s1 |
| InChIKey | DDBJRRSRULFXBC-BYNNNNKLSA-N |
| XLogP | 3.20 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | 594 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|