C25H33F3N2O3 — CID 118722413
[(2S,3aS,7aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methyl cyclopentanecarboxylate (PubChem CID 118722413) has the molecular formula C25H33F3N2O3 and a molecular weight of 466.54 g/mol. Its IUPAC name is [(2S,3aS,7aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methyl cyclopentanecarboxylate.
| Compound Name | [(2S,3aS,7aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methyl cyclopentanecarboxylate |
|---|---|
| PubChem CID | 118722413 |
| Molecular Formula | C25H33F3N2O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | [(2S,3aS,7aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methyl cyclopentanecarboxylate |
| SMILES | N[C@@H](CC(=O)N1[C@H](COC(=O)C2CCCC2)C[C@@H]2CCCC[C@@H]21)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C25H33F3N2O3/c26-20-13-22(28)21(27)11-17(20)9-18(29)12-24(31)30-19(10-16-7-3-4-8-23(16)30)14-33-25(32)15-5-1-2-6-15/h11,13,15-16,18-19,23H,1-10,12,14,29H2/t16-,18+,19-,23-/m0/s1 |
| InChIKey | HZKRKRMDFDMUHJ-FAODYONGSA-N |
| XLogP | 4.26 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|