C22H30N2O2 — CID 42567257
ethyl 4-(cyclopropylmethyl)-1-[(2-methyl-1H-indol-3-yl)methyl]piperidine-4-carboxylate (PubChem CID 42567257) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is ethyl 4-(cyclopropylmethyl)-1-[(2-methyl-1H-indol-3-yl)methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 4-(cyclopropylmethyl)-1-[(2-methyl-1H-indol-3-yl)methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42567257 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | ethyl 4-(cyclopropylmethyl)-1-[(2-methyl-1H-indol-3-yl)methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(CC2CC2)CCN(Cc2c(C)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C22H30N2O2/c1-3-26-21(25)22(14-17-8-9-17)10-12-24(13-11-22)15-19-16(2)23-20-7-5-4-6-18(19)20/h4-7,17,23H,3,8-15H2,1-2H3 |
| InChIKey | QEWLWXIOEQFHGZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|