C18H27Cl2N3 — CID 171687135
2-[(2-methyl-1H-indol-3-yl)methyl]-2,8-diazaspiro[4.5]decane;dihydrochloride (PubChem CID 171687135) has the molecular formula C18H27Cl2N3 and a molecular weight of 356.34 g/mol. Its IUPAC name is 2-[(2-methyl-1H-indol-3-yl)methyl]-2,8-diazaspiro[4.5]decane;dihydrochloride.
| Compound Name | 2-[(2-methyl-1H-indol-3-yl)methyl]-2,8-diazaspiro[4.5]decane;dihydrochloride |
|---|---|
| PubChem CID | 171687135 |
| Molecular Formula | C18H27Cl2N3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 2-[(2-methyl-1H-indol-3-yl)methyl]-2,8-diazaspiro[4.5]decane;dihydrochloride |
| SMILES | Cc1[nH]c2ccccc2c1CN1CCC2(CCNCC2)C1.Cl.Cl |
| InChI | InChI=1S/C18H25N3.2ClH/c1-14-16(15-4-2-3-5-17(15)20-14)12-21-11-8-18(13-21)6-9-19-10-7-18;;/h2-5,19-20H,6-13H2,1H3;2*1H |
| InChIKey | PSGJOJQIZPGOEG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|