C23H24N2O3 — CID 42569166
(6R)-5-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-3-ethyl-6-phenyl-1,6-dihydropyrimidin-2-one (PubChem CID 42569166) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is (6R)-5-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-3-ethyl-6-phenyl-1,6-dihydropyrimidin-2-one.
| Compound Name | (6R)-5-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-3-ethyl-6-phenyl-1,6-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 42569166 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (6R)-5-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-3-ethyl-6-phenyl-1,6-dihydropyrimidin-2-one |
| SMILES | CCOc1ccc(/C=C/C(=O)C2=CN(CC)C(=O)N[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2O3/c1-3-25-16-20(22(24-23(25)27)18-8-6-5-7-9-18)21(26)15-12-17-10-13-19(14-11-17)28-4-2/h5-16,22H,3-4H2,1-2H3,(H,24,27)/b15-12+/t22-/m1/s1 |
| InChIKey | NQDMXKOFTSLCEK-OWSFEGEDSA-N |
| XLogP | 4.34 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|