C21H19FN2O2 — CID 42649763
3-ethyl-5-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one (PubChem CID 42649763) has the molecular formula C21H19FN2O2 and a molecular weight of 350.39 g/mol. Its IUPAC name is 3-ethyl-5-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one.
| Compound Name | 3-ethyl-5-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 42649763 |
| Molecular Formula | C21H19FN2O2 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 3-ethyl-5-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one |
| SMILES | CCN1C=C(C(=O)/C=C/c2ccc(F)cc2)C(c2ccccc2)NC1=O |
| InChI | InChI=1S/C21H19FN2O2/c1-2-24-14-18(19(25)13-10-15-8-11-17(22)12-9-15)20(23-21(24)26)16-6-4-3-5-7-16/h3-14,20H,2H2,1H3,(H,23,26)/b13-10+ |
| InChIKey | DCDUKTHLWBTWEY-JLHYYAGUSA-N |
| XLogP | 4.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|