About N-prop-2-enylbutanamide
N-prop-2-enylbutanamide (PubChem CID 4257022) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is N-prop-2-enylbutanamide.
Molecular Properties
| Compound Name | N-prop-2-enylbutanamide |
| PubChem CID | 4257022 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | N-prop-2-enylbutanamide |
| SMILES | C=CCNC(=O)CCC |
| InChI | InChI=1S/C7H13NO/c1-3-5-7(9)8-6-4-2/h4H,2-3,5-6H2,1H3,(H,8,9) |
| InChIKey | KTJYOKLCBAFHDD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enylbutanamide?
The IUPAC name of N-prop-2-enylbutanamide (CID 4257022) is N-prop-2-enylbutanamide.
What is the SMILES notation for N-prop-2-enylbutanamide?
The canonical SMILES for N-prop-2-enylbutanamide is C=CCNC(=O)CCC.
What is the InChIKey of N-prop-2-enylbutanamide?
The InChIKey is KTJYOKLCBAFHDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO/c1-3-5-7(9)8-6-4-2/h4H,2-3,5-6H2,1H3,(H,8,9).
What are the key properties of N-prop-2-enylbutanamide?
N-prop-2-enylbutanamide has a molecular weight of 127.19 g/mol, XLogP of 1.09, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enylbutanamide is sourced from PubChem (CID 4257022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).