C18H29N2OS+ — CID 4257482
N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide (PubChem CID 4257482) has the molecular formula C18H29N2OS+ and a molecular weight of 321.51 g/mol. Its IUPAC name is N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide.
| Compound Name | N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide |
|---|---|
| PubChem CID | 4257482 |
| Molecular Formula | C18H29N2OS+ |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide |
| SMILES | CC1(C)CC(NC(=O)c2scc3c2CCCC3)CC(C)(C)[NH2+]1 |
| InChI | InChI=1S/C18H28N2OS/c1-17(2)9-13(10-18(3,4)20-17)19-16(21)15-14-8-6-5-7-12(14)11-22-15/h11,13,20H,5-10H2,1-4H3,(H,19,21)/p+1 |
| InChIKey | DJSDRXGYOIQOJG-UHFFFAOYSA-O |
| XLogP | 2.64 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |