C16H15N3O3S — CID 42581704
N-[4-oxo-4-(1,3-thiazol-2-ylamino)butyl]-1-benzofuran-2-carboxamide (PubChem CID 42581704) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is N-[4-oxo-4-(1,3-thiazol-2-ylamino)butyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-oxo-4-(1,3-thiazol-2-ylamino)butyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 42581704 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N-[4-oxo-4-(1,3-thiazol-2-ylamino)butyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(CCCNC(=O)c1cc2ccccc2o1)Nc1nccs1 |
| InChI | InChI=1S/C16H15N3O3S/c20-14(19-16-18-8-9-23-16)6-3-7-17-15(21)13-10-11-4-1-2-5-12(11)22-13/h1-2,4-5,8-10H,3,6-7H2,(H,17,21)(H,18,19,20) |
| InChIKey | VRECNUSBSRWYDX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|