C21H19N5O5S — CID 42583771
ethyl (4S)-6-(1H-benzimidazol-2-ylsulfanylmethyl)-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 42583771) has the molecular formula C21H19N5O5S and a molecular weight of 453.48 g/mol. Its IUPAC name is ethyl (4S)-6-(1H-benzimidazol-2-ylsulfanylmethyl)-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-6-(1H-benzimidazol-2-ylsulfanylmethyl)-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42583771 |
| Molecular Formula | C21H19N5O5S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | ethyl (4S)-6-(1H-benzimidazol-2-ylsulfanylmethyl)-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(CSc2nc3ccccc3[nH]2)NC(=O)N[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H19N5O5S/c1-2-31-19(27)17-16(11-32-21-23-14-8-3-4-9-15(14)24-21)22-20(28)25-18(17)12-6-5-7-13(10-12)26(29)30/h3-10,18H,2,11H2,1H3,(H,23,24)(H2,22,25,28)/t18-/m0/s1 |
| InChIKey | NHRKTOMYMLWPDX-SFHVURJKSA-N |
| XLogP | 3.43 |
| TPSA | 139.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|