C9H15N3O3 — CID 42587700
5-[(2R)-2-hydroxypentan-2-yl]-1,2-oxazole-3-carbohydrazide (PubChem CID 42587700) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 5-[(2R)-2-hydroxypentan-2-yl]-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-[(2R)-2-hydroxypentan-2-yl]-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 42587700 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 5-[(2R)-2-hydroxypentan-2-yl]-1,2-oxazole-3-carbohydrazide |
| SMILES | CCC[C@@](C)(O)c1cc(C(=O)NN)no1 |
| InChI | InChI=1S/C9H15N3O3/c1-3-4-9(2,14)7-5-6(12-15-7)8(13)11-10/h5,14H,3-4,10H2,1-2H3,(H,11,13)/t9-/m1/s1 |
| InChIKey | UXBHBBHHHJFNAO-SECBINFHSA-N |
| XLogP | 0.29 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|