C18H16N6S2 — CID 42594644
N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-5-naphthalen-1-yl-1,2,4-triazin-3-amine (PubChem CID 42594644) has the molecular formula C18H16N6S2 and a molecular weight of 380.50 g/mol. Its IUPAC name is N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-5-naphthalen-1-yl-1,2,4-triazin-3-amine.
| Compound Name | N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-5-naphthalen-1-yl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 42594644 |
| Molecular Formula | C18H16N6S2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-5-naphthalen-1-yl-1,2,4-triazin-3-amine |
| SMILES | Cc1nnc(SCCNc2nncc(-c3cccc4ccccc34)n2)s1 |
| InChI | InChI=1S/C18H16N6S2/c1-12-22-24-18(26-12)25-10-9-19-17-21-16(11-20-23-17)15-8-4-6-13-5-2-3-7-14(13)15/h2-8,11H,9-10H2,1H3,(H,19,21,23) |
| InChIKey | ZNNCRLBHIHLBDN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|