C21H26F3N5O2 — CID 42596179
N-[3-(2-methylimidazol-1-yl)propyl]-2-[(2R)-3-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]piperazin-2-yl]acetamide (PubChem CID 42596179) has the molecular formula C21H26F3N5O2 and a molecular weight of 437.47 g/mol. Its IUPAC name is N-[3-(2-methylimidazol-1-yl)propyl]-2-[(2R)-3-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]piperazin-2-yl]acetamide.
| Compound Name | N-[3-(2-methylimidazol-1-yl)propyl]-2-[(2R)-3-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]piperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 42596179 |
| Molecular Formula | C21H26F3N5O2 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | N-[3-(2-methylimidazol-1-yl)propyl]-2-[(2R)-3-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]piperazin-2-yl]acetamide |
| SMILES | Cc1nccn1CCCNC(=O)C[C@@H]1C(=O)NCCN1Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H26F3N5O2/c1-15-25-8-11-28(15)10-4-7-26-19(30)13-18-20(31)27-9-12-29(18)14-16-5-2-3-6-17(16)21(22,23)24/h2-3,5-6,8,11,18H,4,7,9-10,12-14H2,1H3,(H,26,30)(H,27,31)/t18-/m1/s1 |
| InChIKey | JOZFRLZUNYNYED-GOSISDBHSA-N |
| XLogP | 2.11 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|