C18H25NO4S — CID 42597733
[(3S,5S)-1-(4-methylphenyl)sulfonyl-5-(2-methylprop-1-enyl)pyrrolidin-3-yl]methyl acetate (PubChem CID 42597733) has the molecular formula C18H25NO4S and a molecular weight of 351.47 g/mol. Its IUPAC name is [(3S,5S)-1-(4-methylphenyl)sulfonyl-5-(2-methylprop-1-enyl)pyrrolidin-3-yl]methyl acetate.
| Compound Name | [(3S,5S)-1-(4-methylphenyl)sulfonyl-5-(2-methylprop-1-enyl)pyrrolidin-3-yl]methyl acetate |
|---|---|
| PubChem CID | 42597733 |
| Molecular Formula | C18H25NO4S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | [(3S,5S)-1-(4-methylphenyl)sulfonyl-5-(2-methylprop-1-enyl)pyrrolidin-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C[C@@H](C=C(C)C)N(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C18H25NO4S/c1-13(2)9-17-10-16(12-23-15(4)20)11-19(17)24(21,22)18-7-5-14(3)6-8-18/h5-9,16-17H,10-12H2,1-4H3/t16-,17+/m0/s1 |
| InChIKey | XRLDIZMDBVPHCF-DLBZAZTESA-N |
| XLogP | 2.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|