C25H26N2O5 — CID 42598723
6,7-dimethoxy-1-(2-nitrophenyl)-2-(2-phenoxyethyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 42598723) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is 6,7-dimethoxy-1-(2-nitrophenyl)-2-(2-phenoxyethyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6,7-dimethoxy-1-(2-nitrophenyl)-2-(2-phenoxyethyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 42598723 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 6,7-dimethoxy-1-(2-nitrophenyl)-2-(2-phenoxyethyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1[N+](=O)[O-])N(CCOc1ccccc1)CC2 |
| InChI | InChI=1S/C25H26N2O5/c1-30-23-16-18-12-13-26(14-15-32-19-8-4-3-5-9-19)25(21(18)17-24(23)31-2)20-10-6-7-11-22(20)27(28)29/h3-11,16-17,25H,12-15H2,1-2H3 |
| InChIKey | LHNJVWFGOZBFDI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|