C26H28N2O6 — CID 42598724
6,7-dimethoxy-1-(5-methoxy-2-nitrophenyl)-2-(2-phenoxyethyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 42598724) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is 6,7-dimethoxy-1-(5-methoxy-2-nitrophenyl)-2-(2-phenoxyethyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6,7-dimethoxy-1-(5-methoxy-2-nitrophenyl)-2-(2-phenoxyethyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 42598724 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 6,7-dimethoxy-1-(5-methoxy-2-nitrophenyl)-2-(2-phenoxyethyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1ccc([N+](=O)[O-])c(C2c3cc(OC)c(OC)cc3CCN2CCOc2ccccc2)c1 |
| InChI | InChI=1S/C26H28N2O6/c1-31-20-9-10-23(28(29)30)22(16-20)26-21-17-25(33-3)24(32-2)15-18(21)11-12-27(26)13-14-34-19-7-5-4-6-8-19/h4-10,15-17,26H,11-14H2,1-3H3 |
| InChIKey | XUURCLJGCPKDLG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|