C24H21BrN4O2 — CID 42602924
1-[(4-bromophenyl)methyl]-5-methyl-N-(4-phenylmethoxyphenyl)triazole-4-carboxamide (PubChem CID 42602924) has the molecular formula C24H21BrN4O2 and a molecular weight of 477.36 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-5-methyl-N-(4-phenylmethoxyphenyl)triazole-4-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]-5-methyl-N-(4-phenylmethoxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 42602924 |
| Molecular Formula | C24H21BrN4O2 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-5-methyl-N-(4-phenylmethoxyphenyl)triazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(OCc3ccccc3)cc2)nnn1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H21BrN4O2/c1-17-23(27-28-29(17)15-18-7-9-20(25)10-8-18)24(30)26-21-11-13-22(14-12-21)31-16-19-5-3-2-4-6-19/h2-14H,15-16H2,1H3,(H,26,30) |
| InChIKey | VLHWEZFLDJJCDG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |