C23H28N4O2 — CID 42602928
5-methyl-N-[4-(3-methylbutoxy)phenyl]-1-[(4-methylphenyl)methyl]triazole-4-carboxamide (PubChem CID 42602928) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 5-methyl-N-[4-(3-methylbutoxy)phenyl]-1-[(4-methylphenyl)methyl]triazole-4-carboxamide.
| Compound Name | 5-methyl-N-[4-(3-methylbutoxy)phenyl]-1-[(4-methylphenyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 42602928 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 5-methyl-N-[4-(3-methylbutoxy)phenyl]-1-[(4-methylphenyl)methyl]triazole-4-carboxamide |
| SMILES | Cc1ccc(Cn2nnc(C(=O)Nc3ccc(OCCC(C)C)cc3)c2C)cc1 |
| InChI | InChI=1S/C23H28N4O2/c1-16(2)13-14-29-21-11-9-20(10-12-21)24-23(28)22-18(4)27(26-25-22)15-19-7-5-17(3)6-8-19/h5-12,16H,13-15H2,1-4H3,(H,24,28) |
| InChIKey | RUCRPYJZPZYPKP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |