About dimethyl 4-[[1-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino]benzene-1,2-dicarboxylate
dimethyl 4-[[1-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino]benzene-1,2-dicarboxylate (PubChem CID 59583408) has the molecular formula C21H19FN4O5
and a molecular weight of 426.40 g/mol. Its IUPAC name is dimethyl 4-[[1-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino]benzene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 4-[[1-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino]benzene-1,2-dicarboxylate |
| PubChem CID | 59583408 |
| Molecular Formula | C21H19FN4O5 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | dimethyl 4-[[1-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino]benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(NC(=O)c2nnn(Cc3ccc(F)cc3)c2C)cc1C(=O)OC |
| InChI | InChI=1S/C21H19FN4O5/c1-12-18(24-25-26(12)11-13-4-6-14(22)7-5-13)19(27)23-15-8-9-16(20(28)30-2)17(10-15)21(29)31-3/h4-10H,11H2,1-3H3,(H,23,27) |
| InChIKey | TYRYNAWWROOWSD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze dimethyl 4-[[1-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino]benzene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 4-[[1-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino]benzene-1,2-dicarboxylate?
The IUPAC name of dimethyl 4-[[1-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino]benzene-1,2-dicarboxylate (CID 59583408) is dimethyl 4-[[1-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino]benzene-1,2-dicarboxylate.
What is the SMILES notation for dimethyl 4-[[1-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino]benzene-1,2-dicarboxylate?
The canonical SMILES for dimethyl 4-[[1-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino]benzene-1,2-dicarboxylate is COC(=O)c1ccc(NC(=O)c2nnn(Cc3ccc(F)cc3)c2C)cc1C(=O)OC.
What is the InChIKey of dimethyl 4-[[1-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino]benzene-1,2-dicarboxylate?
The InChIKey is TYRYNAWWROOWSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19FN4O5/c1-12-18(24-25-26(12)11-13-4-6-14(22)7-5-13)19(27)23-15-8-9-16(20(28)30-2)17(10-15)21(29)31-3/h4-10H,11H2,1-3H3,(H,23,27).
What are the key properties of dimethyl 4-[[1-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino]benzene-1,2-dicarboxylate?
dimethyl 4-[[1-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino]benzene-1,2-dicarboxylate has a molecular weight of 426.40 g/mol, XLogP of 2.60, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 4-[[1-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carbonyl]amino]benzene-1,2-dicarboxylate is sourced from PubChem (CID 59583408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).