C19H16N4O5 — CID 67381998
4-[(1-benzyl-5-methyltriazole-4-carbonyl)amino]phthalic acid (PubChem CID 67381998) has the molecular formula C19H16N4O5 and a molecular weight of 380.36 g/mol. Its IUPAC name is 4-[(1-benzyl-5-methyltriazole-4-carbonyl)amino]phthalic acid.
| Compound Name | 4-[(1-benzyl-5-methyltriazole-4-carbonyl)amino]phthalic acid |
|---|---|
| PubChem CID | 67381998 |
| Molecular Formula | C19H16N4O5 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 4-[(1-benzyl-5-methyltriazole-4-carbonyl)amino]phthalic acid |
| SMILES | Cc1c(C(=O)Nc2ccc(C(=O)O)c(C(=O)O)c2)nnn1Cc1ccccc1 |
| InChI | InChI=1S/C19H16N4O5/c1-11-16(21-22-23(11)10-12-5-3-2-4-6-12)17(24)20-13-7-8-14(18(25)26)15(9-13)19(27)28/h2-9H,10H2,1H3,(H,20,24)(H,25,26)(H,27,28) |
| InChIKey | NJZPVLNZWDRHMF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |