C21H36O2 — CID 42604061
(1R,4E,8E,12S,16R)-16-methoxy-4,8,12,14,14-pentamethyl-13-oxabicyclo[10.2.2]hexadeca-4,8-diene (PubChem CID 42604061) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is (1R,4E,8E,12S,16R)-16-methoxy-4,8,12,14,14-pentamethyl-13-oxabicyclo[10.2.2]hexadeca-4,8-diene.
| Compound Name | (1R,4E,8E,12S,16R)-16-methoxy-4,8,12,14,14-pentamethyl-13-oxabicyclo[10.2.2]hexadeca-4,8-diene |
|---|---|
| PubChem CID | 42604061 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | (1R,4E,8E,12S,16R)-16-methoxy-4,8,12,14,14-pentamethyl-13-oxabicyclo[10.2.2]hexadeca-4,8-diene |
| SMILES | CO[C@@H]1C[C@H]2CC/C(C)=C/CC/C(C)=C/CC[C@]1(C)OC2(C)C |
| InChI | InChI=1S/C21H36O2/c1-16-9-7-10-17(2)12-13-18-15-19(22-6)21(5,14-8-11-16)23-20(18,3)4/h10-11,18-19H,7-9,12-15H2,1-6H3/b16-11+,17-10+/t18-,19-,21+/m1/s1 |
| InChIKey | JKVCSIMGSWXUCF-BJBJDZSYSA-N |
| XLogP | 5.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|