C17H16ClN7O3S — CID 42604904
(3-chlorophenyl)-[4-[5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazol-2-yl]piperazin-1-yl]methanone (PubChem CID 42604904) has the molecular formula C17H16ClN7O3S and a molecular weight of 433.88 g/mol. Its IUPAC name is (3-chlorophenyl)-[4-[5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazol-2-yl]piperazin-1-yl]methanone.
| Compound Name | (3-chlorophenyl)-[4-[5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazol-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42604904 |
| Molecular Formula | C17H16ClN7O3S |
| Molecular Weight | 433.88 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | (3-chlorophenyl)-[4-[5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazol-2-yl]piperazin-1-yl]methanone |
| SMILES | Cn1c([N+](=O)[O-])cnc1-c1nnc(N2CCN(C(=O)c3cccc(Cl)c3)CC2)s1 |
| InChI | InChI=1S/C17H16ClN7O3S/c1-22-13(25(27)28)10-19-14(22)15-20-21-17(29-15)24-7-5-23(6-8-24)16(26)11-3-2-4-12(18)9-11/h2-4,9-10H,5-8H2,1H3 |
| InChIKey | TYJAEQOSJXOCCG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.88 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|