C25H22N8O4S — CID 68998373
[4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]-[4-[5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazol-2-yl]piperazin-1-yl]methanone (PubChem CID 68998373) has the molecular formula C25H22N8O4S and a molecular weight of 530.57 g/mol. Its IUPAC name is [4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]-[4-[5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazol-2-yl]piperazin-1-yl]methanone.
| Compound Name | [4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]-[4-[5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazol-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 68998373 |
| Molecular Formula | C25H22N8O4S |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | [4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]-[4-[5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazol-2-yl]piperazin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCN(c3nnc(-c4ncc([N+](=O)[O-])n4C)s3)CC2)cc1C#Cc1ccccn1 |
| InChI | InChI=1S/C25H22N8O4S/c1-30-21(33(35)36)16-27-22(30)23-28-29-25(38-23)32-13-11-31(12-14-32)24(34)18-7-9-20(37-2)17(15-18)6-8-19-5-3-4-10-26-19/h3-5,7,9-10,15-16H,11-14H2,1-2H3 |
| InChIKey | BDYHWTCQDCPYNH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 132.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|