C32H52N5O9 — CID 42605397
CID 42605397 (PubChem CID 42605397) has the molecular formula C32H52N5O9 and a molecular weight of 650.79 g/mol.
| Compound Name | CID 42605397 |
|---|---|
| PubChem CID | 42605397 |
| Molecular Formula | C32H52N5O9 |
| Molecular Weight | 650.79 g/mol |
| Exact Mass | 650.38 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OC(C)(C)C)CCN(C(=O)C(CO)NC(=O)[C]2[CH][CH][CH][CH]2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C32H52N5O9/c1-30(2,3)44-27(41)35-16-14-34(26(40)24(22-38)33-25(39)23-12-10-11-13-23)15-17-36(28(42)45-31(4,5)6)19-21-37(20-18-35)29(43)46-32(7,8)9/h10-13,24,38H,14-22H2,1-9H3,(H,33,39) |
| InChIKey | WSEQEMFFLSOWPP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 158.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.79 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|