C21H18ClN3O — CID 42605490
1-(4-chlorophenyl)-1-(3-imidazol-1-ylpropyl)-3H-2-benzofuran-5-carbonitrile (PubChem CID 42605490) has the molecular formula C21H18ClN3O and a molecular weight of 363.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1-(3-imidazol-1-ylpropyl)-3H-2-benzofuran-5-carbonitrile.
| Compound Name | 1-(4-chlorophenyl)-1-(3-imidazol-1-ylpropyl)-3H-2-benzofuran-5-carbonitrile |
|---|---|
| PubChem CID | 42605490 |
| Molecular Formula | C21H18ClN3O |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 1-(4-chlorophenyl)-1-(3-imidazol-1-ylpropyl)-3H-2-benzofuran-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)COC2(CCCn1ccnc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18ClN3O/c22-19-5-3-18(4-6-19)21(8-1-10-25-11-9-24-15-25)20-7-2-16(13-23)12-17(20)14-26-21/h2-7,9,11-12,15H,1,8,10,14H2 |
| InChIKey | PYSKJOZKABINOH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |