C7H5FN2O — CID 42609147
5-fluoro-1,2-benzoxazol-3-amine (PubChem CID 42609147) has the molecular formula C7H5FN2O and a molecular weight of 152.13 g/mol. Its IUPAC name is 5-fluoro-1,2-benzoxazol-3-amine.
| Compound Name | 5-fluoro-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 42609147 |
| Molecular Formula | C7H5FN2O |
| Molecular Weight | 152.13 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 5-fluoro-1,2-benzoxazol-3-amine |
| SMILES | Nc1noc2ccc(F)cc12 |
| InChI | InChI=1S/C7H5FN2O/c8-4-1-2-6-5(3-4)7(9)10-11-6/h1-3H,(H2,9,10) |
| InChIKey | MBKJAWUGNSKUIU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.13 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |