C16H21N5O — CID 42624219
12-methoxy-N,N,5-trimethyl-3-propyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine (PubChem CID 42624219) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 12-methoxy-N,N,5-trimethyl-3-propyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine.
| Compound Name | 12-methoxy-N,N,5-trimethyl-3-propyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine |
|---|---|
| PubChem CID | 42624219 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 12-methoxy-N,N,5-trimethyl-3-propyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine |
| SMILES | CCCc1nc(C)c2c(N(C)C)nc3ccc(OC)nc3n12 |
| InChI | InChI=1S/C16H21N5O/c1-6-7-12-17-10(2)14-16(20(3)4)18-11-8-9-13(22-5)19-15(11)21(12)14/h8-9H,6-7H2,1-5H3 |
| InChIKey | SLKDUSRQPIAILN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |